![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| short i, a story.docx | 2025-11-29 10:33 | 41K | |
| Yell,Yell,Yell.docx | 2025-11-29 10:33 | 6.6K | |
| Untitled document.docx | 2025-11-29 10:33 | 41K | |
| Trey Makes Pancakes ..> | 2025-11-29 10:33 | 6.9K | |
| Tom and his Trumpet...> | 2025-11-29 10:33 | 6.9K | |
| The dog and the Bug...> | 2025-11-29 10:33 | 6.7K | |
| The Long Hike i-e Ri..> | 2025-11-29 10:33 | 6.8K | |
| The Long Hike i-e.docx | 2025-11-29 10:33 | 6.8K | |
| The King and the Los..> | 2025-11-29 10:33 | 6.6K | |
| The Ink Spot.docx | 2025-11-29 10:33 | 6.6K | |
| The Hot Hot Dog.docx | 2025-11-29 10:33 | 6.5K | |
| The Class Picnic ( c..> | 2025-11-29 10:33 | 6.7K | |
| The Bug RA SH.docx | 2025-11-29 10:33 | 6.6K | |
| The Bug.docx | 2025-11-29 10:33 | 6.6K | |
| Sylvie_s Sale.docx | 2025-11-29 10:33 | 6.5K | |
| Sylvie_s Frog.docx | 2025-11-29 10:33 | 6.9K | |
| Stella the Whiz Ki..> | 2025-11-29 10:33 | 6.6K | |
| Stella and Riley a-..> | 2025-11-29 10:33 | 6.9K | |
| Short a Story.docx | 2025-11-29 10:33 | 6.6K | |
| Sh_Ch OG story.docx | 2025-11-29 10:33 | 6.6K | |
| Riley and her Pup.docx | 2025-11-29 10:33 | 6.5K | |
| Payton and justin a-..> | 2025-11-29 10:33 | 6.9K | |
| Payton_s Frog.docx | 2025-11-29 10:33 | 6.9K | |
| Old Pals Jake.docx | 2025-11-29 10:33 | 6.9K | |
| Old Pals.docx | 2025-11-29 10:33 | 6.9K | |
| Milo Makes Pancakes ..> | 2025-11-29 10:33 | 65K | |
| Max is Late Again!.docx | 2025-11-29 10:33 | 8.0K | |
| Link_s Mink.docx | 2025-11-29 10:33 | 6.6K | |
| Lazo Makes Pancakes..> | 2025-11-29 10:33 | 6.9K | |
| Keaton_s Wild Colt.docx | 2025-11-29 10:33 | 7.1K | |
| Kalie The Hot Hot D..> | 2025-11-29 10:33 | 6.5K | |
| Justin the Whiz Kid..> | 2025-11-29 10:33 | 6.6K | |
| Justin and the Red A..> | 2025-11-29 10:33 | 6.5K | |
| Justin and the Fish ..> | 2025-11-29 10:33 | 6.8K | |
| Justin and Payton.docx | 2025-11-29 10:33 | 6.7K | |
| Henry and his Trumpe..> | 2025-11-29 10:33 | 6.7K | |
| Dylan and Sylvie_s W..> | 2025-11-29 10:33 | 7.1K | |
| Copy of Riley and th..> | 2025-11-29 10:33 | 6.8K | |
| Copy of Cecilia can ..> | 2025-11-29 10:33 | 138K | |
| Cecilia can make muf..> | 2025-11-29 10:33 | 139K | |
| Cecilia Makes Pancak..> | 2025-11-29 10:33 | 65K | |
| CJ was Late Again!.docx | 2025-11-29 10:33 | 6.9K | |
| Blake and his Pig.docx | 2025-11-29 10:33 | 6.6K | |
| Basketball Dreams.docx | 2025-11-29 10:33 | 7.3K | |
| At Lunch sh_ch stor..> | 2025-11-29 10:33 | 6.8K | |
| A Whiz Kid.docx | 2025-11-29 10:33 | 6.6K | |
| A Scare.docx | 2025-11-29 10:33 | 6.9K | |
| A Kind of Fairy Tale..> | 2025-11-29 10:33 | 7.9K | |
| A Gift from a Pal.docx | 2025-11-29 10:33 | 105K | |
| A Case of the Fidget..> | 2025-11-29 10:33 | 6.9K | |