![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0 BLANK Kind Lesson ..> | 2025-11-29 10:31 | 874K | |
| 00 Blank mid-end yr ..> | 2025-11-29 10:31 | 862K | |
| 1 Beginning of the y..> | 2025-11-29 10:31 | 562K | |
| Blends- s _ l _r Ki..> | 2025-11-29 10:31 | 2.4M | |
| EOY K Snap Word Revi..> | 2025-11-29 10:31 | 263K | |
| EOY Kind LESSON expo..> | 2025-11-29 10:31 | 320K | |
| Kind LESSON WRITE UP..> | 2025-11-29 10:31 | 320K | |
| Tam in the Sand.docx | 2025-11-29 10:31 | 88K | |